About phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate
phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate (PubChem CID 20811768) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate.
Molecular Properties
| Compound Name | phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate |
| PubChem CID | 20811768 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate |
| SMILES | CCC(/N=C(\NC#N)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O/c1-2-16(14-9-5-3-6-10-14)20-17(19-13-18)21-15-11-7-4-8-12-15/h3-12,16H,2H2,1H3,(H,19,20) |
| InChIKey | TZPFLIHICRSEBS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate?
The IUPAC name of phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate (CID 20811768) is phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate.
What is the SMILES notation for phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate?
The canonical SMILES for phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate is CCC(/N=C(\NC#N)Oc1ccccc1)c1ccccc1.
What is the InChIKey of phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate?
The InChIKey is TZPFLIHICRSEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O/c1-2-16(14-9-5-3-6-10-14)20-17(19-13-18)21-15-11-7-4-8-12-15/h3-12,16H,2H2,1H3,(H,19,20).
What are the key properties of phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate?
phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate has a molecular weight of 279.34 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-cyano-N'-(1-phenylpropyl)carbamimidate is sourced from PubChem (CID 20811768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).