C11H21F3N2 — CID 20811808
1-(3-methylbutyl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 20811808) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-(3-methylbutyl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(3-methylbutyl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 20811808 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(3-methylbutyl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | CC(C)CCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2/c1-10(2)3-4-15-5-7-16(8-6-15)9-11(12,13)14/h10H,3-9H2,1-2H3 |
| InChIKey | QPKRAUXJSRPNID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |