C8H17F2N — CID 20811852
N-(2,2-difluoroethyl)-N,3-dimethylbutan-1-amine (PubChem CID 20811852) has the molecular formula C8H17F2N and a molecular weight of 165.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N,3-dimethylbutan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 20811852 |
| Molecular Formula | C8H17F2N |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)CC(F)F |
| InChI | InChI=1S/C8H17F2N/c1-7(2)4-5-11(3)6-8(9)10/h7-8H,4-6H2,1-3H3 |
| InChIKey | YAPAOMYTFFDZEU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |