C23H23NO — CID 20813152
N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2,4-dimethylaniline (PubChem CID 20813152) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2,4-dimethylaniline.
| Compound Name | N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 20813152 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2,4-dimethylaniline |
| SMILES | COc1cccc(/C=C/c2ccc(Nc3ccc(C)cc3C)cc2)c1 |
| InChI | InChI=1S/C23H23NO/c1-17-7-14-23(18(2)15-17)24-21-12-10-19(11-13-21)8-9-20-5-4-6-22(16-20)25-3/h4-16,24H,1-3H3/b9-8+ |
| InChIKey | CQQQHCFWKDELNY-CMDGGOBGSA-N |
| XLogP | 6.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|