C18H27NO — CID 20813394
4,4-dimethyl-2-(4-phenylhexan-2-yl)-5,6-dihydro-1,3-oxazine (PubChem CID 20813394) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 4,4-dimethyl-2-(4-phenylhexan-2-yl)-5,6-dihydro-1,3-oxazine.
| Compound Name | 4,4-dimethyl-2-(4-phenylhexan-2-yl)-5,6-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 20813394 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4,4-dimethyl-2-(4-phenylhexan-2-yl)-5,6-dihydro-1,3-oxazine |
| SMILES | CCC(CC(C)C1=NC(C)(C)CCO1)c1ccccc1 |
| InChI | InChI=1S/C18H27NO/c1-5-15(16-9-7-6-8-10-16)13-14(2)17-19-18(3,4)11-12-20-17/h6-10,14-15H,5,11-13H2,1-4H3 |
| InChIKey | CBUNCCHEBKPJBR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |