C22H23N3O5S — CID 2081397
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 2081397) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2081397 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-3-25(4-2)31(27,28)19-13-10-17(11-14-19)12-15-21(26)29-16-20-23-24-22(30-20)18-8-6-5-7-9-18/h5-15H,3-4,16H2,1-2H3/b15-12+ |
| InChIKey | KFFNEXKXWAAPLY-NTCAYCPXSA-N |
| XLogP | 3.52 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|