C20H25N5O2S — CID 20814292
4-methyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine (PubChem CID 20814292) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-methyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 20814292 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-methyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(Nc2ncnc3cc(OCCCN4CCOCC4)c(C)cc23)n1 |
| InChI | InChI=1S/C20H25N5O2S/c1-14-10-16-17(21-13-22-19(16)24-20-23-15(2)12-28-20)11-18(14)27-7-3-4-25-5-8-26-9-6-25/h10-13H,3-9H2,1-2H3,(H,21,22,23,24) |
| InChIKey | YEGSONUFCPBUPG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|