C7H13Ac3BrO4 — CID 20816009
actinium;2-(bromomethyl)-6-methyloxane-3,4,5-triol (PubChem CID 20816009) has the molecular formula C7H13Ac3BrO4 and a molecular weight of 922.08 g/mol. Its IUPAC name is actinium;2-(bromomethyl)-6-methyloxane-3,4,5-triol.
| Compound Name | actinium;2-(bromomethyl)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 20816009 |
| Molecular Formula | C7H13Ac3BrO4 |
| Molecular Weight | 922.08 g/mol |
| Exact Mass | 921.08 |
| IUPAC Name | actinium;2-(bromomethyl)-6-methyloxane-3,4,5-triol |
| SMILES | CC1OC(CBr)C(O)C(O)C1O.[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C7H13BrO4.3Ac/c1-3-5(9)7(11)6(10)4(2-8)12-3;;;/h3-7,9-11H,2H2,1H3;;; |
| InChIKey | YVSNPPABQVQZBW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.08 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|