C19H15ClIN3O — CID 20816139
1-(4-chlorophenyl)-6-(4-iodophenyl)-3-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one (PubChem CID 20816139) has the molecular formula C19H15ClIN3O and a molecular weight of 463.71 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-(4-iodophenyl)-3-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one.
| Compound Name | 1-(4-chlorophenyl)-6-(4-iodophenyl)-3-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
|---|---|
| PubChem CID | 20816139 |
| Molecular Formula | C19H15ClIN3O |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | 1-(4-chlorophenyl)-6-(4-iodophenyl)-3-methyl-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2c1CCN(c1ccc(I)cc1)C2=O |
| InChI | InChI=1S/C19H15ClIN3O/c1-12-17-10-11-23(15-8-4-14(21)5-9-15)19(25)18(17)24(22-12)16-6-2-13(20)3-7-16/h2-9H,10-11H2,1H3 |
| InChIKey | WBLLVKLIALLOMO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|