C18H19N5O3S — CID 20818346
2-[3-[[3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)anilino]methoxy]anilino]propanoic acid (PubChem CID 20818346) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-[3-[[3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)anilino]methoxy]anilino]propanoic acid.
| Compound Name | 2-[3-[[3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)anilino]methoxy]anilino]propanoic acid |
|---|---|
| PubChem CID | 20818346 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[3-[[3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)anilino]methoxy]anilino]propanoic acid |
| SMILES | CC(Nc1cccc(OCNc2cccc(-n3cn[nH]c3=S)c2)c1)C(=O)O |
| InChI | InChI=1S/C18H19N5O3S/c1-12(17(24)25)21-14-5-3-7-16(9-14)26-11-19-13-4-2-6-15(8-13)23-10-20-22-18(23)27/h2-10,12,19,21H,11H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | WCCCKTHPRJUECS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|