C19H21N5O2SSi — CID 58884341
CID 58884341 (PubChem CID 58884341) has the molecular formula C19H21N5O2SSi and a molecular weight of 411.56 g/mol.
| Compound Name | CID 58884341 |
|---|---|
| PubChem CID | 58884341 |
| Molecular Formula | C19H21N5O2SSi |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | — |
| SMILES | C[Si]C(CO)N(CC(=O)Nc1cccc(-n2cn[nH]c2=S)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21N5O2SSi/c1-28-18(12-25)23(15-7-3-2-4-8-15)11-17(26)21-14-6-5-9-16(10-14)24-13-20-22-19(24)27/h2-10,13,18,25H,11-12H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | BZCWCLKMMRQEBA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|