C22H25N3OS — CID 25337492
3-(4-tert-butylphenyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]propanamide (PubChem CID 25337492) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 25337492 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)Nc2cccc(-n3cc[nH]c3=S)c2)cc1 |
| InChI | InChI=1S/C22H25N3OS/c1-22(2,3)17-10-7-16(8-11-17)9-12-20(26)24-18-5-4-6-19(15-18)25-14-13-23-21(25)27/h4-8,10-11,13-15H,9,12H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | QXJRVCQVKNFEPB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|