C12H19NO2 — CID 20820154
3-acetyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one (PubChem CID 20820154) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-acetyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one.
| Compound Name | 3-acetyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 20820154 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-acetyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
| SMILES | CC(=O)C1CC2CC(=O)CCC2CN1C |
| InChI | InChI=1S/C12H19NO2/c1-8(14)12-6-10-5-11(15)4-3-9(10)7-13(12)2/h9-10,12H,3-7H2,1-2H3 |
| InChIKey | KJMITKKGPMWBAH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |