C11H26N4O — CID 20820352
1,3-bis(4-aminopentan-2-yl)urea (PubChem CID 20820352) has the molecular formula C11H26N4O and a molecular weight of 230.36 g/mol. Its IUPAC name is 1,3-bis(4-aminopentan-2-yl)urea.
| Compound Name | 1,3-bis(4-aminopentan-2-yl)urea |
|---|---|
| PubChem CID | 20820352 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 1,3-bis(4-aminopentan-2-yl)urea |
| SMILES | CC(N)CC(C)NC(=O)NC(C)CC(C)N |
| InChI | InChI=1S/C11H26N4O/c1-7(12)5-9(3)14-11(16)15-10(4)6-8(2)13/h7-10H,5-6,12-13H2,1-4H3,(H2,14,15,16) |
| InChIKey | FLADQUWXWYHJGY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |