C32H34O4Si — CID 20820592
1-[4-[3-[methyl(diphenyl)silyl]oxypropyl]phenoxy]-3-(4-methylphenoxy)propan-2-one (PubChem CID 20820592) has the molecular formula C32H34O4Si and a molecular weight of 510.71 g/mol. Its IUPAC name is 1-[4-[3-[methyl(diphenyl)silyl]oxypropyl]phenoxy]-3-(4-methylphenoxy)propan-2-one.
| Compound Name | 1-[4-[3-[methyl(diphenyl)silyl]oxypropyl]phenoxy]-3-(4-methylphenoxy)propan-2-one |
|---|---|
| PubChem CID | 20820592 |
| Molecular Formula | C32H34O4Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1-[4-[3-[methyl(diphenyl)silyl]oxypropyl]phenoxy]-3-(4-methylphenoxy)propan-2-one |
| SMILES | Cc1ccc(OCC(=O)COc2ccc(CCCO[Si](C)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O4Si/c1-26-15-19-29(20-16-26)34-24-28(33)25-35-30-21-17-27(18-22-30)10-9-23-36-37(2,31-11-5-3-6-12-31)32-13-7-4-8-14-32/h3-8,11-22H,9-10,23-25H2,1-2H3 |
| InChIKey | OXTRTDMBDWKAFW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|