C18H21ClN4O2 — CID 20820679
6-chloro-3-(5-methoxypentyl)-4-phenylmethoxytriazolo[4,5-c]pyridine (PubChem CID 20820679) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 6-chloro-3-(5-methoxypentyl)-4-phenylmethoxytriazolo[4,5-c]pyridine.
| Compound Name | 6-chloro-3-(5-methoxypentyl)-4-phenylmethoxytriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 20820679 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 6-chloro-3-(5-methoxypentyl)-4-phenylmethoxytriazolo[4,5-c]pyridine |
| SMILES | COCCCCCn1nnc2cc(Cl)nc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C18H21ClN4O2/c1-24-11-7-3-6-10-23-17-15(21-22-23)12-16(19)20-18(17)25-13-14-8-4-2-5-9-14/h2,4-5,8-9,12H,3,6-7,10-11,13H2,1H3 |
| InChIKey | DOVCWNZLXUXBBD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|