C12H11F3O6S — CID 20823782
[3-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 20823782) has the molecular formula C12H11F3O6S and a molecular weight of 340.28 g/mol. Its IUPAC name is [3-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 20823782 |
| Molecular Formula | C12H11F3O6S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [3-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CC1(C)OC(=O)C(c2cccc(OS(=O)(=O)C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C12H11F3O6S/c1-11(2)19-9(10(16)20-11)7-4-3-5-8(6-7)21-22(17,18)12(13,14)15/h3-6,9H,1-2H3 |
| InChIKey | OCHRMEQQFBILCN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|