C12H13F3O6S — CID 58822887
methyl 2-methoxy-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 58822887) has the molecular formula C12H13F3O6S and a molecular weight of 342.29 g/mol. Its IUPAC name is methyl 2-methoxy-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl 2-methoxy-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 58822887 |
| Molecular Formula | C12H13F3O6S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | methyl 2-methoxy-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | COC(=O)C(Cc1cccc(OS(=O)(=O)C(F)(F)F)c1)OC |
| InChI | InChI=1S/C12H13F3O6S/c1-19-10(11(16)20-2)7-8-4-3-5-9(6-8)21-22(17,18)12(13,14)15/h3-6,10H,7H2,1-2H3 |
| InChIKey | ZCORAPCZQOEFIT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|