C17H11F6NO — CID 20824679
1,1,1-trifluoro-2-[4-[4-isocyano-3-(trifluoromethyl)phenyl]phenyl]propan-2-ol (PubChem CID 20824679) has the molecular formula C17H11F6NO and a molecular weight of 359.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[4-isocyano-3-(trifluoromethyl)phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[4-isocyano-3-(trifluoromethyl)phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 20824679 |
| Molecular Formula | C17H11F6NO |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[4-isocyano-3-(trifluoromethyl)phenyl]phenyl]propan-2-ol |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(C(C)(O)C(F)(F)F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H11F6NO/c1-15(25,17(21,22)23)12-6-3-10(4-7-12)11-5-8-14(24-2)13(9-11)16(18,19)20/h3-9,25H,1H3 |
| InChIKey | PPJDAQOXYATBCZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|