C9H13F5N2 — CID 20825451
2-(tert-butylamino)-4,4,5,5,5-pentafluoropentanenitrile (PubChem CID 20825451) has the molecular formula C9H13F5N2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-(tert-butylamino)-4,4,5,5,5-pentafluoropentanenitrile.
| Compound Name | 2-(tert-butylamino)-4,4,5,5,5-pentafluoropentanenitrile |
|---|---|
| PubChem CID | 20825451 |
| Molecular Formula | C9H13F5N2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(tert-butylamino)-4,4,5,5,5-pentafluoropentanenitrile |
| SMILES | CC(C)(C)NC(C#N)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5N2/c1-7(2,3)16-6(5-15)4-8(10,11)9(12,13)14/h6,16H,4H2,1-3H3 |
| InChIKey | AONSVAZMJSVHGU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|