C25H16FN5OS3 — CID 2082605
2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile (PubChem CID 2082605) has the molecular formula C25H16FN5OS3 and a molecular weight of 517.64 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile.
| Compound Name | 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 2082605 |
| Molecular Formula | C25H16FN5OS3 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nnc(-c2cccs2)n1-c1ccccc1)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C25H16FN5OS3/c26-17-10-8-16(9-11-17)20-14-34-24(28-20)19(13-27)21(32)15-35-25-30-29-23(22-7-4-12-33-22)31(25)18-5-2-1-3-6-18/h1-12,14,32H,15H2 |
| InChIKey | REYALCTWUMJJDC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|