About fluoro 2-deuterio-2,2-difluoroacetate
fluoro 2-deuterio-2,2-difluoroacetate (PubChem CID 20826380) has the molecular formula C2HF3O2
and a molecular weight of 115.03 g/mol. Its IUPAC name is fluoro 2-deuterio-2,2-difluoroacetate.
Molecular Properties
| Compound Name | fluoro 2-deuterio-2,2-difluoroacetate |
| PubChem CID | 20826380 |
| Molecular Formula | C2HF3O2 |
| Molecular Weight | 115.03 g/mol |
| Exact Mass | 115.00 |
| IUPAC Name | fluoro 2-deuterio-2,2-difluoroacetate |
| SMILES | [2H]C(F)(F)C(=O)OF |
| InChI | InChI=1S/C2HF3O2/c3-1(4)2(6)7-5/h1H/i1D |
| InChIKey | GETPKFJALYLGLT-MICDWDOJSA-N |
| XLogP | 0.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.03 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoro 2-deuterio-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-deuterio-2,2-difluoroacetate?
The IUPAC name of fluoro 2-deuterio-2,2-difluoroacetate (CID 20826380) is fluoro 2-deuterio-2,2-difluoroacetate.
What is the SMILES notation for fluoro 2-deuterio-2,2-difluoroacetate?
The canonical SMILES for fluoro 2-deuterio-2,2-difluoroacetate is [2H]C(F)(F)C(=O)OF.
What is the InChIKey of fluoro 2-deuterio-2,2-difluoroacetate?
The InChIKey is GETPKFJALYLGLT-MICDWDOJSA-N. The full InChI is InChI=1S/C2HF3O2/c3-1(4)2(6)7-5/h1H/i1D.
What are the key properties of fluoro 2-deuterio-2,2-difluoroacetate?
fluoro 2-deuterio-2,2-difluoroacetate has a molecular weight of 115.03 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-deuterio-2,2-difluoroacetate is sourced from PubChem (CID 20826380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).