C22H23N2O2S+ — CID 20826386
7-(diethylamino)-4-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)chromen-2-one (PubChem CID 20826386) has the molecular formula C22H23N2O2S+ and a molecular weight of 379.51 g/mol. Its IUPAC name is 7-(diethylamino)-4-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)chromen-2-one.
| Compound Name | 7-(diethylamino)-4-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 20826386 |
| Molecular Formula | C22H23N2O2S+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 7-(diethylamino)-4-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2c(C)c(-c3sc4ccccc4[n+]3C)c(=O)oc2c1 |
| InChI | InChI=1S/C22H23N2O2S/c1-5-24(6-2)15-11-12-16-14(3)20(22(25)26-18(16)13-15)21-23(4)17-9-7-8-10-19(17)27-21/h7-13H,5-6H2,1-4H3/q+1 |
| InChIKey | DWORJXVWPYBHJO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|