C21H13F4N5O2 — CID 20826946
4-N-quinolin-3-yl-2-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine (PubChem CID 20826946) has the molecular formula C21H13F4N5O2 and a molecular weight of 443.36 g/mol. Its IUPAC name is 4-N-quinolin-3-yl-2-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-quinolin-3-yl-2-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20826946 |
| Molecular Formula | C21H13F4N5O2 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-N-quinolin-3-yl-2-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine |
| SMILES | FC1(F)Oc2ccc(Nc3nccc(Nc4cnc5ccccc5c4)n3)cc2OC1(F)F |
| InChI | InChI=1S/C21H13F4N5O2/c22-20(23)21(24,25)32-17-10-13(5-6-16(17)31-20)29-19-26-8-7-18(30-19)28-14-9-12-3-1-2-4-15(12)27-11-14/h1-11H,(H2,26,28,29,30) |
| InChIKey | DHPFQUNYRIKXNI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|