C19H14N6O2 — CID 20826973
2-N-(4-nitrophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine (PubChem CID 20826973) has the molecular formula C19H14N6O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-N-(4-nitrophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-nitrophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20826973 |
| Molecular Formula | C19H14N6O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-N-(4-nitrophenyl)-4-N-quinolin-3-ylpyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nccc(Nc3cnc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C19H14N6O2/c26-25(27)16-7-5-14(6-8-16)23-19-20-10-9-18(24-19)22-15-11-13-3-1-2-4-17(13)21-12-15/h1-12H,(H2,20,22,23,24) |
| InChIKey | VZTFQSZVCJWFEN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|