C29H35F5N4O4 — CID 20827448
(E)-5-amino-N-[3-(4-methoxyphenyl)-1-[methyl-[1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]-N,5-dimethylhex-2-enamide (PubChem CID 20827448) has the molecular formula C29H35F5N4O4 and a molecular weight of 598.61 g/mol. Its IUPAC name is (E)-5-amino-N-[3-(4-methoxyphenyl)-1-[methyl-[1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]-N,5-dimethylhex-2-enamide.
| Compound Name | (E)-5-amino-N-[3-(4-methoxyphenyl)-1-[methyl-[1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]-N,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 20827448 |
| Molecular Formula | C29H35F5N4O4 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | (E)-5-amino-N-[3-(4-methoxyphenyl)-1-[methyl-[1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]-N,5-dimethylhex-2-enamide |
| SMILES | CNC(=O)C(Cc1c(F)c(F)c(F)c(F)c1F)N(C)C(=O)C(Cc1ccc(OC)cc1)N(C)C(=O)/C=C/CC(C)(C)N |
| InChI | InChI=1S/C29H35F5N4O4/c1-29(2,35)13-7-8-21(39)37(4)20(14-16-9-11-17(42-6)12-10-16)28(41)38(5)19(27(40)36-3)15-18-22(30)24(32)26(34)25(33)23(18)31/h7-12,19-20H,13-15,35H2,1-6H3,(H,36,40)/b8-7+ |
| InChIKey | JCBRVDMBCXJVSP-BQYQJAHWSA-N |
| XLogP | 3.26 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|