C28H33F5N4O3 — CID 59057247
(E)-5-amino-N,5-dimethyl-N-[(2R)-1-[methyl-[(2R)-1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hex-2-enamide (PubChem CID 59057247) has the molecular formula C28H33F5N4O3 and a molecular weight of 568.59 g/mol. Its IUPAC name is (E)-5-amino-N,5-dimethyl-N-[(2R)-1-[methyl-[(2R)-1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hex-2-enamide.
| Compound Name | (E)-5-amino-N,5-dimethyl-N-[(2R)-1-[methyl-[(2R)-1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hex-2-enamide |
|---|---|
| PubChem CID | 59057247 |
| Molecular Formula | C28H33F5N4O3 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (E)-5-amino-N,5-dimethyl-N-[(2R)-1-[methyl-[(2R)-1-(methylamino)-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hex-2-enamide |
| SMILES | CNC(=O)[C@@H](Cc1c(F)c(F)c(F)c(F)c1F)N(C)C(=O)[C@@H](Cc1ccccc1)N(C)C(=O)/C=C/CC(C)(C)N |
| InChI | InChI=1S/C28H33F5N4O3/c1-28(2,34)13-9-12-20(38)36(4)19(14-16-10-7-6-8-11-16)27(40)37(5)18(26(39)35-3)15-17-21(29)23(31)25(33)24(32)22(17)30/h6-12,18-19H,13-15,34H2,1-5H3,(H,35,39)/b12-9+/t18-,19-/m1/s1 |
| InChIKey | JILYBCBCYIIXTP-FCJQBXHQSA-N |
| XLogP | 3.25 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|