C24H28N2O5 — CID 20831101
methyl (13E,14S,16S,18S)-18-(acetyloxymethyl)-13-ethylidene-5-methoxy-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2(7),3,5,8(17)-tetraene-18-carboxylate (PubChem CID 20831101) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl (13E,14S,16S,18S)-18-(acetyloxymethyl)-13-ethylidene-5-methoxy-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2(7),3,5,8(17)-tetraene-18-carboxylate.
| Compound Name | methyl (13E,14S,16S,18S)-18-(acetyloxymethyl)-13-ethylidene-5-methoxy-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2(7),3,5,8(17)-tetraene-18-carboxylate |
|---|---|
| PubChem CID | 20831101 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl (13E,14S,16S,18S)-18-(acetyloxymethyl)-13-ethylidene-5-methoxy-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2(7),3,5,8(17)-tetraene-18-carboxylate |
| SMILES | C/C=C1/CN2CCc3c4n(c5ccc(OC)cc35)[C@@](COC(C)=O)(C(=O)OC)[C@H]1C[C@@H]42 |
| InChI | InChI=1S/C24H28N2O5/c1-5-15-12-25-9-8-17-18-10-16(29-3)6-7-20(18)26-22(17)21(25)11-19(15)24(26,23(28)30-4)13-31-14(2)27/h5-7,10,19,21H,8-9,11-13H2,1-4H3/b15-5-/t19-,21-,24+/m0/s1 |
| InChIKey | BCHPBZINTQEKMM-WPCXBUEESA-N |
| XLogP | 2.96 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|