C23H28N2O4 — CID 74766726
methyl (1R,15R,17S,18S)-7-acetyloxy-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate (PubChem CID 74766726) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl (1R,15R,17S,18S)-7-acetyloxy-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate.
| Compound Name | methyl (1R,15R,17S,18S)-7-acetyloxy-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 74766726 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl (1R,15R,17S,18S)-7-acetyloxy-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate |
| SMILES | CC[C@H]1C[C@@H]2C[C@H]3c4c(c5cc(OC(C)=O)ccc5n4C(=O)OC)CCN(C2)[C@@H]13 |
| InChI | InChI=1S/C23H28N2O4/c1-4-15-9-14-10-19-21(15)24(12-14)8-7-17-18-11-16(29-13(2)26)5-6-20(18)25(22(17)19)23(27)28-3/h5-6,11,14-15,19,21H,4,7-10,12H2,1-3H3/t14-,15+,19-,21+/m1/s1 |
| InChIKey | CYJKJXCVCPXTKV-HPTYEUTDSA-N |
| XLogP | 3.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|