C20H24N2O2 — CID 75148940
16-ethyl-6-methoxy-10,12-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2,4(9),5,7-tetraene-3-carbaldehyde (PubChem CID 75148940) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 16-ethyl-6-methoxy-10,12-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2,4(9),5,7-tetraene-3-carbaldehyde.
| Compound Name | 16-ethyl-6-methoxy-10,12-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2,4(9),5,7-tetraene-3-carbaldehyde |
|---|---|
| PubChem CID | 75148940 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 16-ethyl-6-methoxy-10,12-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2,4(9),5,7-tetraene-3-carbaldehyde |
| SMILES | CCC1CC2CC3c4c(C=O)c5cc(OC)ccc5n4CN(C2)C13 |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-6-12-7-16-19(13)21(9-12)11-22-18-5-4-14(24-2)8-15(18)17(10-23)20(16)22/h4-5,8,10,12-13,16,19H,3,6-7,9,11H2,1-2H3 |
| InChIKey | LMCFLZDRZRNFNJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|