C21H30N2O — CID 123348026
2-(10-ethyl-7-methyl-3-azatricyclo[6.3.1.03,9]dodec-6-en-6-yl)-4-methoxyaniline (PubChem CID 123348026) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-(10-ethyl-7-methyl-3-azatricyclo[6.3.1.03,9]dodec-6-en-6-yl)-4-methoxyaniline.
| Compound Name | 2-(10-ethyl-7-methyl-3-azatricyclo[6.3.1.03,9]dodec-6-en-6-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 123348026 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 2-(10-ethyl-7-methyl-3-azatricyclo[6.3.1.03,9]dodec-6-en-6-yl)-4-methoxyaniline |
| SMILES | CCC1CC2CC3C(C)=C(c4cc(OC)ccc4N)CCN(C2)C13 |
| InChI | InChI=1S/C21H30N2O/c1-4-15-9-14-10-18-13(2)17(7-8-23(12-14)21(15)18)19-11-16(24-3)5-6-20(19)22/h5-6,11,14-15,18,21H,4,7-10,12,22H2,1-3H3 |
| InChIKey | AGNXSUISUSLRJV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|