C11H13N7S — CID 20833596
[(E)-[1-(4-ethylphenyl)tetrazol-5-yl]methylideneamino]thiourea (PubChem CID 20833596) has the molecular formula C11H13N7S and a molecular weight of 275.34 g/mol. Its IUPAC name is [(E)-[1-(4-ethylphenyl)tetrazol-5-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[1-(4-ethylphenyl)tetrazol-5-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 20833596 |
| Molecular Formula | C11H13N7S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [(E)-[1-(4-ethylphenyl)tetrazol-5-yl]methylideneamino]thiourea |
| SMILES | CCc1ccc(-n2nnnc2/C=N/NC(N)=S)cc1 |
| InChI | InChI=1S/C11H13N7S/c1-2-8-3-5-9(6-4-8)18-10(14-16-17-18)7-13-15-11(12)19/h3-7H,2H2,1H3,(H3,12,15,19)/b13-7+ |
| InChIKey | MVAPCJUZIDIOJF-NTUHNPAUSA-N |
| XLogP | 0.39 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|