C31H52N2O — CID 20836461
N-[(E)-[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]acetamide (PubChem CID 20836461) has the molecular formula C31H52N2O and a molecular weight of 468.77 g/mol. Its IUPAC name is N-[(E)-[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]acetamide.
| Compound Name | N-[(E)-[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 20836461 |
| Molecular Formula | C31H52N2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.41 |
| IUPAC Name | N-[(E)-[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]acetamide |
| SMILES | CC(=O)N/N=C1\CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1(C)C |
| InChI | InChI=1S/C31H52N2O/c1-20(2)10-9-11-21(3)24-13-14-25-23-12-15-27-29(5,6)28(33-32-22(4)34)17-19-31(27,8)26(23)16-18-30(24,25)7/h15,20-21,23-26H,9-14,16-19H2,1-8H3,(H,32,34)/b33-28+/t21-,23+,24-,25+,26+,30-,31-/m1/s1 |
| InChIKey | RCFQMFZAFWOVMT-HONOXQLJSA-N |
| XLogP | 8.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|