C27H34N2O7 — CID 20838274
(E)-but-2-enedioic acid;3-ethoxy-3-phenyl-1-(2-piperidin-1-ylethyl)indol-2-one;hydrate (PubChem CID 20838274) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-ethoxy-3-phenyl-1-(2-piperidin-1-ylethyl)indol-2-one;hydrate.
| Compound Name | (E)-but-2-enedioic acid;3-ethoxy-3-phenyl-1-(2-piperidin-1-ylethyl)indol-2-one;hydrate |
|---|---|
| PubChem CID | 20838274 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (E)-but-2-enedioic acid;3-ethoxy-3-phenyl-1-(2-piperidin-1-ylethyl)indol-2-one;hydrate |
| SMILES | CCOC1(c2ccccc2)C(=O)N(CCN2CCCCC2)c2ccccc21.O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H28N2O2.C4H4O4.H2O/c1-2-27-23(19-11-5-3-6-12-19)20-13-7-8-14-21(20)25(22(23)26)18-17-24-15-9-4-10-16-24;5-3(6)1-2-4(7)8;/h3,5-8,11-14H,2,4,9-10,15-18H2,1H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1+; |
| InChIKey | YAYRXFJOCMFAFL-JITBQSAISA-N |
| XLogP | 2.69 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|