C23H29N3O — CID 97356397
(3R)-1-(dimethylamino)-3-phenyl-3-(2-piperidin-1-ylethyl)indol-2-one (PubChem CID 97356397) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is (3R)-1-(dimethylamino)-3-phenyl-3-(2-piperidin-1-ylethyl)indol-2-one.
| Compound Name | (3R)-1-(dimethylamino)-3-phenyl-3-(2-piperidin-1-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 97356397 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (3R)-1-(dimethylamino)-3-phenyl-3-(2-piperidin-1-ylethyl)indol-2-one |
| SMILES | CN(C)N1C(=O)[C@](CCN2CCCCC2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O/c1-24(2)26-21-14-8-7-13-20(21)23(22(26)27,19-11-5-3-6-12-19)15-18-25-16-9-4-10-17-25/h3,5-8,11-14H,4,9-10,15-18H2,1-2H3/t23-/m1/s1 |
| InChIKey | RCNWGRRPIQNGGP-HSZRJFAPSA-N |
| XLogP | 3.67 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |