C29H33ClN2O — CID 139786250
1-ethyl-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-2-one;hydrochloride (PubChem CID 139786250) has the molecular formula C29H33ClN2O and a molecular weight of 461.05 g/mol. Its IUPAC name is 1-ethyl-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-2-one;hydrochloride.
| Compound Name | 1-ethyl-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 139786250 |
| Molecular Formula | C29H33ClN2O |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-ethyl-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-2-one;hydrochloride |
| SMILES | CCN1C(=O)C(CCN2CCC(c3ccccc3)CC2)(c2ccccc2)c2ccccc21.Cl |
| InChI | InChI=1S/C29H32N2O.ClH/c1-2-31-27-16-10-9-15-26(27)29(28(31)32,25-13-7-4-8-14-25)19-22-30-20-17-24(18-21-30)23-11-5-3-6-12-23;/h3-16,24H,2,17-22H2,1H3;1H |
| InChIKey | ICUUIXJSERMVEF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |