C31H37N3O — CID 67669564
6-(diethylamino)-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]-1H-indol-2-one (PubChem CID 67669564) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is 6-(diethylamino)-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]-1H-indol-2-one.
| Compound Name | 6-(diethylamino)-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 67669564 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 6-(diethylamino)-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]-1H-indol-2-one |
| SMILES | CCN(CC)c1ccc2c(c1)NC(=O)C2(CCN1CCC(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H37N3O/c1-3-34(4-2)27-15-16-28-29(23-27)32-30(35)31(28,26-13-9-6-10-14-26)19-22-33-20-17-25(18-21-33)24-11-7-5-8-12-24/h5-16,23,25H,3-4,17-22H2,1-2H3,(H,32,35) |
| InChIKey | DSQYUFLKDFVWNV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |