C38H37N3O3 — CID 57118627
2-[3-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 57118627) has the molecular formula C38H37N3O3 and a molecular weight of 583.73 g/mol. Its IUPAC name is 2-[3-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57118627 |
| Molecular Formula | C38H37N3O3 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 2-[3-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN1C(=O)C(CCN2CCC(c3ccccc3)CC2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C38H37N3O3/c42-35-31-16-7-8-17-32(31)36(43)41(35)24-11-23-40-34-19-10-9-18-33(34)38(37(40)44,30-14-5-2-6-15-30)22-27-39-25-20-29(21-26-39)28-12-3-1-4-13-28/h1-10,12-19,29H,11,20-27H2 |
| InChIKey | LFSLKYXEHHBDRX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|