C34H41ClN2O3 — CID 139786241
5-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]pentyl acetate;hydrochloride (PubChem CID 139786241) has the molecular formula C34H41ClN2O3 and a molecular weight of 561.17 g/mol. Its IUPAC name is 5-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]pentyl acetate;hydrochloride.
| Compound Name | 5-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]pentyl acetate;hydrochloride |
|---|---|
| PubChem CID | 139786241 |
| Molecular Formula | C34H41ClN2O3 |
| Molecular Weight | 561.17 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 5-[2-oxo-3-phenyl-3-[2-(4-phenylpiperidin-1-yl)ethyl]indol-1-yl]pentyl acetate;hydrochloride |
| SMILES | CC(=O)OCCCCCN1C(=O)C(CCN2CCC(c3ccccc3)CC2)(c2ccccc2)c2ccccc21.Cl |
| InChI | InChI=1S/C34H40N2O3.ClH/c1-27(37)39-26-12-4-11-22-36-32-18-10-9-17-31(32)34(33(36)38,30-15-7-3-8-16-30)21-25-35-23-19-29(20-24-35)28-13-5-2-6-14-28;/h2-3,5-10,13-18,29H,4,11-12,19-26H2,1H3;1H |
| InChIKey | IZHOAABGJZKDEI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.17 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|