C28H31N3O — CID 97356417
(3R)-1-[benzyl(methyl)amino]-3-phenyl-3-(2-pyrrolidin-1-ylethyl)indol-2-one (PubChem CID 97356417) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is (3R)-1-[benzyl(methyl)amino]-3-phenyl-3-(2-pyrrolidin-1-ylethyl)indol-2-one.
| Compound Name | (3R)-1-[benzyl(methyl)amino]-3-phenyl-3-(2-pyrrolidin-1-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 97356417 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (3R)-1-[benzyl(methyl)amino]-3-phenyl-3-(2-pyrrolidin-1-ylethyl)indol-2-one |
| SMILES | CN(Cc1ccccc1)N1C(=O)[C@](CCN2CCCC2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H31N3O/c1-29(22-23-12-4-2-5-13-23)31-26-17-9-8-16-25(26)28(27(31)32,24-14-6-3-7-15-24)18-21-30-19-10-11-20-30/h2-9,12-17H,10-11,18-22H2,1H3/t28-/m1/s1 |
| InChIKey | UMIRICKXLRUXRF-MUUNZHRXSA-N |
| XLogP | 4.85 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |