C28H31NO5 — CID 20839864
(Z)-but-2-enedioic acid;(1S,5R)-8-methyl-3-[(5-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]-8-azabicyclo[3.2.1]octane (PubChem CID 20839864) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(1S,5R)-8-methyl-3-[(5-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | (Z)-but-2-enedioic acid;(1S,5R)-8-methyl-3-[(5-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 20839864 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;(1S,5R)-8-methyl-3-[(5-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1ccc2c(c1)C(OC1C[C@H]3CC[C@@H](C1)N3C)c1ccccc1C=C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H27NO.C4H4O4/c1-16-7-8-18-10-9-17-5-3-4-6-22(17)24(23(18)13-16)26-21-14-19-11-12-20(15-21)25(19)2;5-3(6)1-2-4(7)8/h3-10,13,19-21,24H,11-12,14-15H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t19-,20+,21?,24?; |
| InChIKey | WUEPTNSAPUVRJL-YTOMWFGPSA-N |
| XLogP | 4.92 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|