About bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine
bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine (PubChem CID 20840318) has the molecular formula C20H22N2O8-4
and a molecular weight of 418.40 g/mol. Its IUPAC name is bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine.
Molecular Properties
| Compound Name | bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine |
| PubChem CID | 20840318 |
| Molecular Formula | C20H22N2O8-4 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(CN2CCNCC2)cc1.O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C12H18N2.2C4H4O4/c1-11-2-4-12(5-3-11)10-14-8-6-13-7-9-14;2*5-3(6)1-2-4(7)8/h2-5,13H,6-10H2,1H3;2*1-2H,(H,5,6)(H,7,8)/p-4/b;2*2-1- |
| InChIKey | NUUCALHLARACKO-SPIKMXEPSA-J |
| XLogP | -4.51 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine?
The IUPAC name of bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine (CID 20840318) is bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine.
What is the SMILES notation for bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine?
The canonical SMILES for bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine is Cc1ccc(CN2CCNCC2)cc1.O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-].
What is the InChIKey of bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine?
The InChIKey is NUUCALHLARACKO-SPIKMXEPSA-J. The full InChI is InChI=1S/C12H18N2.2C4H4O4/c1-11-2-4-12(5-3-11)10-14-8-6-13-7-9-14;2*5-3(6)1-2-4(7)8/h2-5,13H,6-10H2,1H3;2*1-2H,(H,5,6)(H,7,8)/p-4/b;2*2-1-.
What are the key properties of bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine?
bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine has a molecular weight of 418.40 g/mol, XLogP of -4.51, 6 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-but-2-enedioate);1-[(4-methylphenyl)methyl]piperazine is sourced from PubChem (CID 20840318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).