C22H30N4OS — CID 20845002
1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-1-[(4-propoxyphenyl)methyl]thiourea (PubChem CID 20845002) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-1-[(4-propoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-1-[(4-propoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 20845002 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-1-[(4-propoxyphenyl)methyl]thiourea |
| SMILES | CCCOc1ccc(CN(/N=C/c2ccc(N(CC)CC)cc2)C(N)=S)cc1 |
| InChI | InChI=1S/C22H30N4OS/c1-4-15-27-21-13-9-19(10-14-21)17-26(22(23)28)24-16-18-7-11-20(12-8-18)25(5-2)6-3/h7-14,16H,4-6,15,17H2,1-3H3,(H2,23,28)/b24-16+ |
| InChIKey | BHFVQYDCDVKJQV-LFVJCYFKSA-N |
| XLogP | 4.40 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|