C14H21NO5 — CID 20845293
2-[(3E)-3-(carboxymethoxyimino)-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid (PubChem CID 20845293) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[(3E)-3-(carboxymethoxyimino)-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid.
| Compound Name | 2-[(3E)-3-(carboxymethoxyimino)-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 20845293 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[(3E)-3-(carboxymethoxyimino)-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid |
| SMILES | CC/C=C/CC1/C(=N/OCC(=O)O)CCC1CC(=O)O |
| InChI | InChI=1S/C14H21NO5/c1-2-3-4-5-11-10(8-13(16)17)6-7-12(11)15-20-9-14(18)19/h3-4,10-11H,2,5-9H2,1H3,(H,16,17)(H,18,19)/b4-3+,15-12+ |
| InChIKey | MQQXAMWYRMMMLF-IMEOUHKUSA-N |
| XLogP | 2.30 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|