C23H35NO5 — CID 20845537
4-[[(8R,9S,10S,13S,14S,17Z)-17-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 20845537) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-[[(8R,9S,10S,13S,14S,17Z)-17-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(8R,9S,10S,13S,14S,17Z)-17-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20845537 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 4-[[(8R,9S,10S,13S,14S,17Z)-17-hydroxyimino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@]12CCC(OC(=O)CCC(=O)O)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=N\O)CC[C@@H]12 |
| InChI | InChI=1S/C23H35NO5/c1-22-11-9-15(29-21(27)8-7-20(25)26)13-14(22)3-4-16-17-5-6-19(24-28)23(17,2)12-10-18(16)22/h14-18,28H,3-13H2,1-2H3,(H,25,26)/b24-19-/t14?,15?,16-,17-,18-,22-,23-/m0/s1 |
| InChIKey | XKAMRVKAOPCQFW-LNKSVWGWSA-N |
| XLogP | 4.64 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|