C11H11N3O3S3 — CID 20846983
S-ethyl 3-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]propanethioate (PubChem CID 20846983) has the molecular formula C11H11N3O3S3 and a molecular weight of 329.43 g/mol. Its IUPAC name is S-ethyl 3-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]propanethioate.
| Compound Name | S-ethyl 3-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]propanethioate |
|---|---|
| PubChem CID | 20846983 |
| Molecular Formula | C11H11N3O3S3 |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | S-ethyl 3-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]propanethioate |
| SMILES | CCSC(=O)CCc1nnc(-c2ccc([N+](=O)[O-])s2)s1 |
| InChI | InChI=1S/C11H11N3O3S3/c1-2-18-10(15)6-4-8-12-13-11(20-8)7-3-5-9(19-7)14(16)17/h3,5H,2,4,6H2,1H3 |
| InChIKey | ILLLAYAOPHAOEN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|