C31H57NO7 — CID 20847543
(E)-N-[1-[(1R,4R,5S,6S)-4,6-dihydroxy-3,3,5-trimethyl-2-oxocyclohexyl]-1-hydroxy-3-methoxypropan-2-yl]-7-methoxy-9-methylhexadec-4-enamide (PubChem CID 20847543) has the molecular formula C31H57NO7 and a molecular weight of 555.80 g/mol. Its IUPAC name is (E)-N-[1-[(1R,4R,5S,6S)-4,6-dihydroxy-3,3,5-trimethyl-2-oxocyclohexyl]-1-hydroxy-3-methoxypropan-2-yl]-7-methoxy-9-methylhexadec-4-enamide.
| Compound Name | (E)-N-[1-[(1R,4R,5S,6S)-4,6-dihydroxy-3,3,5-trimethyl-2-oxocyclohexyl]-1-hydroxy-3-methoxypropan-2-yl]-7-methoxy-9-methylhexadec-4-enamide |
|---|---|
| PubChem CID | 20847543 |
| Molecular Formula | C31H57NO7 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.41 |
| IUPAC Name | (E)-N-[1-[(1R,4R,5S,6S)-4,6-dihydroxy-3,3,5-trimethyl-2-oxocyclohexyl]-1-hydroxy-3-methoxypropan-2-yl]-7-methoxy-9-methylhexadec-4-enamide |
| SMILES | CCCCCCCC(C)CC(C/C=C/CCC(=O)NC(COC)C(O)[C@@H]1C(=O)C(C)(C)[C@H](O)[C@@H](C)[C@@H]1O)OC |
| InChI | InChI=1S/C31H57NO7/c1-8-9-10-11-13-16-21(2)19-23(39-7)17-14-12-15-18-25(33)32-24(20-38-6)28(35)26-27(34)22(3)29(36)31(4,5)30(26)37/h12,14,21-24,26-29,34-36H,8-11,13,15-20H2,1-7H3,(H,32,33)/b14-12+/t21?,22-,23?,24?,26+,27-,28?,29+/m0/s1 |
| InChIKey | OOOJZFAEKGDVGZ-CZBCKWEYSA-N |
| XLogP | 4.19 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|