C11H14N2O6 — CID 20848091
2-[formyl-(5-nitrofuran-2-yl)amino]-4-methylpentanoic acid (PubChem CID 20848091) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-[formyl-(5-nitrofuran-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[formyl-(5-nitrofuran-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 20848091 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[formyl-(5-nitrofuran-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N(C=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H14N2O6/c1-7(2)5-8(11(15)16)12(6-14)9-3-4-10(19-9)13(17)18/h3-4,6-8H,5H2,1-2H3,(H,15,16) |
| InChIKey | QQOQVHUQOWTYMP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|