C21H22N2O3S — CID 2084877
N-(2-methoxyethyl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide (PubChem CID 2084877) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-methoxyethyl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2084877 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide |
| SMILES | COCCNC(=O)CSc1cc(-c2ccccc2)c2ccc(OC)cc2n1 |
| InChI | InChI=1S/C21H22N2O3S/c1-25-11-10-22-20(24)14-27-21-13-18(15-6-4-3-5-7-15)17-9-8-16(26-2)12-19(17)23-21/h3-9,12-13H,10-11,14H2,1-2H3,(H,22,24) |
| InChIKey | ILXYJEGTHJVELT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|