About methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate
methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate (PubChem CID 20849739) has the molecular formula C15H18N4OS
and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate |
| PubChem CID | 20849739 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate |
| SMILES | CSC(=N\N=C(\C)c1cc2ccccc2o1)/N=C/N(C)C |
| InChI | InChI=1S/C15H18N4OS/c1-11(17-18-15(21-4)16-10-19(2)3)14-9-12-7-5-6-8-13(12)20-14/h5-10H,1-4H3/b16-10+,17-11-,18-15- |
| InChIKey | VUQWKBJVXSTLOS-CGPIWZAASA-N |
| XLogP | 3.47 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate?
The IUPAC name of methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate (CID 20849739) is methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate.
What is the SMILES notation for methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate?
The canonical SMILES for methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate is CSC(=N\N=C(\C)c1cc2ccccc2o1)/N=C/N(C)C.
What is the InChIKey of methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate?
The InChIKey is VUQWKBJVXSTLOS-CGPIWZAASA-N. The full InChI is InChI=1S/C15H18N4OS/c1-11(17-18-15(21-4)16-10-19(2)3)14-9-12-7-5-6-8-13(12)20-14/h5-10H,1-4H3/b16-10+,17-11-,18-15-.
What are the key properties of methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate?
methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate has a molecular weight of 302.40 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (NE)-N'-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-N-(dimethylaminomethylidene)carbamimidothioate is sourced from PubChem (CID 20849739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).